Name | Vanillyl Butyl Ether |
Synonyms | FEMA 3796 4O1R DQ CO1 Vanillyl Butyl Ether BUTYL VANILLYL ETHER VANILLYL BUTYL ETHER 4-BUTOXY-2-METHOXYPHENOL 4-(Butoxymethyl)-2-methoxyphenol 2-Methoxy-4-(butoxymethyl)phenol Phenol, 4-(butoxymethyl)-2-methoxy- |
CAS | 82654-98-6 |
EINECS | 209-753-1 |
InChI | InChI=1/C12H18O3/c1-3-4-7-15-9-10-5-6-11(13)12(8-10)14-2/h5-6,8,13H,3-4,7,9H2,1-2H3 |
InChIKey | VLDFMKOUUQYFGF-UHFFFAOYSA-N |
Molecular Formula | C12H18O3 |
Molar Mass | 210.27 |
Density | 1.057g/mLat 25°C(lit.) |
Melting Point | EU Regulation 1223/2009 |
Boling Point | 241°C(lit.) |
Flash Point | >230°F |
JECFA Number | 888 |
Water Solubility | 1.79-1690mg/L at 20℃ |
Solubility | soluble (Insoluble in water. Soluble in organic solvents, oils.) |
Vapor Presure | 0.42-2000Pa at 20-25℃ |
Appearance | Transparent liquid |
Specific Gravity | 1.057 |
Color | Colourless |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | n20/D 1.516(lit.) |
MDL | MFCD00238529 |
WGK Germany | 3 |
FEMA | 3796 | VANILLYL BUTYL ETHER |
LogP | 2.2-2.4 at 23-25℃ |
EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
Application | 1. Vanillin Butyl Ether can be used as a cosmetic fragrance for the preparation of other functional compositions. For example, vanillyl butyl ether is used to prepare a cosmetic for chest massage using a plant extract. 2. Vanillin Butyl Ether can also be used in the preparation of hand creams, such as a pitaya hand cream, consisting of the following ingredients: pitaya pulp extract, vanillin butyl ether, chamomile, lemon peel extract, medicinal petrolatum. |
synthesis method | from 4-hydroxy-3-methoxybenzyl alcohol and n-butanol as raw materials, synthesis of vanyl butyl ether, the yield was 99%, and the reaction process was as follows: |
toxicity | GRAS(FEMA). |
usage limit | FEMA(mg/kg): baked goods, snack foods, breakfast cereals, other cereal products, processed vegetables, 5.0~20; Brine products, beverages, wine, soft candy, 2.0~10; Soup, egg products, spices, reconstituted vegetables, sauce, hard candy, gum, 5.0~10. |
biological activity | Vanillyl butyl ether is a major contributor to the unique flavor and aroma of vanilla. Vanillyl butyl ether is an environmentally friendly and non-toxic substance. Vanillyl butyl ether can be a mild warming agent, providing a warm sensation and enhancing blood circulation. |